Products 2937705-58-1
CAS 2937705-58-1 appears in our catalog under these names: AC–green, AC-green, 98%, 98%, AC-green, 98.04%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 10 mg, 5 mg.
2-[[7-(diethylamino)-2-oxochromen-3-yl]carbamoyl]prop-2-enyl N-phenylcarbamate (CAS 2937705-58-1) is a chemical compound with the molecular formula C24H25N3O5 and a molecular weight of 435.5 g/mol. IUPAC name: 2-[[7-(diethylamino)-2-oxochromen-3-yl]carbamoyl]prop-2-enyl N-phenylcarbamate. InChIKey: PHBVJYLDYIFURJ-UHFFFAOYSA-N.
| Molecular formula | C24H25N3O5 |
|---|---|
| Molecular weight | 435.5 g/mol |
| IUPAC name | 2-[[7-(diethylamino)-2-oxochromen-3-yl]carbamoyl]prop-2-enyl N-phenylcarbamate |
| InChIKey | PHBVJYLDYIFURJ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)NC(=O)C(=C)COC(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
AC-green, orb2567117