CAS 2938216-28-3 is the registry number for NSC 357754. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[4-(5-carbamimidoyl-1-benzofuran-2-yl)phenyl]ethenyl]-1-benzofuran-5-carboximidamide (CAS 2938216-28-3) is a chemical compound with the molecular formula C26H20N4O2 and a molecular weight of 420.5 g/mol. IUPAC name: 2-[2-[4-(5-carbamimidoyl-1-benzofuran-2-yl)phenyl]ethenyl]-1-benzofuran-5-carboximidamide. InChIKey: UGAHVRIJHXSWLF-UHFFFAOYSA-N.
| Molecular formula | C26H20N4O2 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 2-[2-[4-(5-carbamimidoyl-1-benzofuran-2-yl)phenyl]ethenyl]-1-benzofuran-5-carboximidamide |
| InChIKey | UGAHVRIJHXSWLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC2=CC3=C(O2)C=CC(=C3)C(=N)N)C4=CC5=C(O4)C=CC(=C5)C(=N)N |
Computed by PubChem (NCBI)