Products 2938989-90-1
CAS 2938989-90-1 appears in our catalog under these names: Avibactam (sodium hydrate), 99.61%, Avibactam (sodium hydrate) (Standard), Avibactam (sodium hydrate). Offered by: MedChemExpress, Chemat. Available pack sizes: 200 mg, 5 mg, 10mM/1mL, 50 mg, 10 mg, 100 mg, 25 mg, 2mg.
Sodium;[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;hydrate (CAS 2938989-90-1) is a chemical compound with the molecular formula C7H12N3NaO7S and a molecular weight of 305.24 g/mol. IUPAC name: sodium;[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;hydrate. InChIKey: QTECZIOYYRSGNA-CIFXRNLBSA-M.
| Molecular formula | C7H12N3NaO7S |
|---|---|
| Molecular weight | 305.24 g/mol |
| IUPAC name | sodium;[(2S,5R)-2-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate;hydrate |
| InChIKey | QTECZIOYYRSGNA-CIFXRNLBSA-M |
| SMILES | C1C[C@H](N2C[C@@H]1N(C2=O)OS(=O)(=O)[O-])C(=O)N.O.[Na+] |
Computed by PubChem (NCBI)