Products 2938997-59-0
CAS 2938997-59-0 is the registry number for Ethyl 5-(3,5-Difluoro-2-pyridyl)isoxazole-3-carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5-(3,5-difluoro-2-pyridinyl)-1,2-oxazole-3-carboxylate (CAS 2938997-59-0) is a chemical compound with the molecular formula C11H8F2N2O3 and a molecular weight of 254.19 g/mol. IUPAC name: ethyl 5-(3,5-difluoro-2-pyridinyl)-1,2-oxazole-3-carboxylate. InChIKey: TXGZLTISWUYRCI-UHFFFAOYSA-N.
| Molecular formula | C11H8F2N2O3 |
|---|---|
| Molecular weight | 254.19 g/mol |
| IUPAC name | ethyl 5-(3,5-difluoro-2-pyridinyl)-1,2-oxazole-3-carboxylate |
| InChIKey | TXGZLTISWUYRCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=C(C=C(C=N2)F)F |
Computed by PubChem (NCBI)