CAS 2939080-11-0 is the registry number for (1-(tert-Butoxycarbonyl)-1H-pyrazolo[3,4-b]pyridin-4-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazolo[3,4-b]pyridin-4-yl]boronic acid (CAS 2939080-11-0) is a chemical compound with the molecular formula C11H14BN3O4 and a molecular weight of 263.06 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazolo[3,4-b]pyridin-4-yl]boronic acid. InChIKey: JNZFYOTTYFCXSE-UHFFFAOYSA-N.
| Molecular formula | C11H14BN3O4 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrazolo[3,4-b]pyridin-4-yl]boronic acid |
| InChIKey | JNZFYOTTYFCXSE-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=NN(C2=NC=C1)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)