CAS 2939846-87-2 is the registry number for 7-Bromo-6-chloro-5,8-difluoro-2-(methylsulfanyl)quinazolin-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-6-chloro-5,8-difluoro-2-methylsulfanyl-3H-quinazolin-4-one (CAS 2939846-87-2) is a chemical compound with the molecular formula C9H4BrClF2N2OS and a molecular weight of 341.56 g/mol. IUPAC name: 7-bromo-6-chloro-5,8-difluoro-2-methylsulfanyl-3H-quinazolin-4-one. InChIKey: WPNCBWRYKSVONB-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClF2N2OS |
|---|---|
| Molecular weight | 341.56 g/mol |
| IUPAC name | 7-bromo-6-chloro-5,8-difluoro-2-methylsulfanyl-3H-quinazolin-4-one |
| InChIKey | WPNCBWRYKSVONB-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=C(C(=C2F)Br)Cl)F)C(=O)N1 |
Computed by PubChem (NCBI)