CAS 2939933-09-0 appears in our catalog under these names: h-NTPDase-IN-4/ 99.92% (existing batch purity), h–NTPDase–IN–4, h-NTPDase-IN-4 98%, h-NTPDase-IN-4, 98.64%, 4,7-Bis(3,5-bis(trifluoromethyl)phenyl)thieno[3,2-d]pyrimidine, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine (CAS 2939933-09-0) is a chemical compound with the molecular formula C22H8F12N2S and a molecular weight of 560.4 g/mol. IUPAC name: 4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine. InChIKey: TYDAPAGFPMDHHZ-UHFFFAOYSA-N.
| Molecular formula | C22H8F12N2S |
|---|---|
| Molecular weight | 560.4 g/mol |
| IUPAC name | 4,7-bis[3,5-bis(trifluoromethyl)phenyl]thieno[3,2-d]pyrimidine |
| InChIKey | TYDAPAGFPMDHHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C2=CSC3=C2N=CN=C3C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)