Products 2940860-58-0
CAS 2940860-58-0 is the registry number for ditert-butyl (2R,5R)-5-hydroxy-5-methyl-piperidine-1,2-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ditert-butyl (2R,5R)-5-hydroxy-5-methylpiperidine-1,2-dicarboxylate (CAS 2940860-58-0) is a chemical compound with the molecular formula C16H29NO5 and a molecular weight of 315.40 g/mol. IUPAC name: ditert-butyl (2R,5R)-5-hydroxy-5-methylpiperidine-1,2-dicarboxylate. InChIKey: SALOJNIUSZBZOH-BDJLRTHQSA-N.
| Molecular formula | C16H29NO5 |
|---|---|
| Molecular weight | 315.40 g/mol |
| IUPAC name | ditert-butyl (2R,5R)-5-hydroxy-5-methylpiperidine-1,2-dicarboxylate |
| InChIKey | SALOJNIUSZBZOH-BDJLRTHQSA-N |
| SMILES | C[C@]1(CC[C@@H](N(C1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)