CAS 2940861-84-5 appears in our catalog under these names: (3R,4S)-N,N,4-Trimethylpyrrolidin-3-amine dihydrochloride, 98%, (3R,4S)-N,N,4-trimethylpyrrolidin-3-amine,dihydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
(3R,4S)-N,N,4-trimethylpyrrolidin-3-amine;dihydrochloride (CAS 2940861-84-5) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: (3R,4S)-N,N,4-trimethylpyrrolidin-3-amine;dihydrochloride. InChIKey: QBMVDWRBENSOLA-JFYKYWLVSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | (3R,4S)-N,N,4-trimethylpyrrolidin-3-amine;dihydrochloride |
| InChIKey | QBMVDWRBENSOLA-JFYKYWLVSA-N |
| SMILES | C[C@H]1CNC[C@@H]1N(C)C.Cl.Cl |
Computed by PubChem (NCBI)