Products 2940867-19-4

CAS 2940867-19-4 is the registry number for benzyl cis-3,5-diaminopiperidine-1-carboxylate dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl (3R,5S)-3,5-diaminopiperidine-1-carboxylate;dihydrochloride (CAS 2940867-19-4) is a chemical compound with the molecular formula C13H21Cl2N3O2 and a molecular weight of 322.2 g/mol. IUPAC name: benzyl (3R,5S)-3,5-diaminopiperidine-1-carboxylate;dihydrochloride. InChIKey: QKFXKYWOCSCANG-FYPKGCJUSA-N.

Identity
Molecular formulaC13H21Cl2N3O2
Molecular weight322.2 g/mol
IUPAC namebenzyl (3R,5S)-3,5-diaminopiperidine-1-carboxylate;dihydrochloride
InChIKeyQKFXKYWOCSCANG-FYPKGCJUSA-N
SMILESC1[C@H](CN(C[C@H]1N)C(=O)OCC2=CC=CC=C2)N.Cl.Cl

Computed by PubChem (NCBI)