CAS 2940867-19-4 is the registry number for benzyl cis-3,5-diaminopiperidine-1-carboxylate dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3R,5S)-3,5-diaminopiperidine-1-carboxylate;dihydrochloride (CAS 2940867-19-4) is a chemical compound with the molecular formula C13H21Cl2N3O2 and a molecular weight of 322.2 g/mol. IUPAC name: benzyl (3R,5S)-3,5-diaminopiperidine-1-carboxylate;dihydrochloride. InChIKey: QKFXKYWOCSCANG-FYPKGCJUSA-N.
| Molecular formula | C13H21Cl2N3O2 |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | benzyl (3R,5S)-3,5-diaminopiperidine-1-carboxylate;dihydrochloride |
| InChIKey | QKFXKYWOCSCANG-FYPKGCJUSA-N |
| SMILES | C1[C@H](CN(C[C@H]1N)C(=O)OCC2=CC=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)