Products 2940869-79-2
CAS 2940869-79-2 is the registry number for trans-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one;hydrochloride (CAS 2940869-79-2) is a chemical compound with the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. IUPAC name: (3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one;hydrochloride. InChIKey: VXGNCPOILAXTAM-GEMLJDPKSA-N.
| Molecular formula | C7H12ClNO |
|---|---|
| Molecular weight | 161.63 g/mol |
| IUPAC name | (3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-one;hydrochloride |
| InChIKey | VXGNCPOILAXTAM-GEMLJDPKSA-N |
| SMILES | C1[C@H]2CNC[C@@H]2CC1=O.Cl |
Computed by PubChem (NCBI)