CAS 2940870-94-8 is the registry number for tert-butyl cis-4-amino-3-(2-methoxy-2-oxo-ethyl)piperidine-1-carboxylate oxalic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-amino-3-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate;oxalic acid (CAS 2940870-94-8) is a chemical compound with the molecular formula C15H26N2O8 and a molecular weight of 362.38 g/mol. IUPAC name: tert-butyl 4-amino-3-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate;oxalic acid. InChIKey: JSWBTOQKQGQMPP-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O8 |
|---|---|
| Molecular weight | 362.38 g/mol |
| IUPAC name | tert-butyl 4-amino-3-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate;oxalic acid |
| InChIKey | JSWBTOQKQGQMPP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)CC(=O)OC)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)