Products 2940868-36-8

CAS 2940868-36-8 is the registry number for O1-tert-butyl O2-ethyl (2R,5R)-5-aminopiperidine-1,2-dicarboxylate,oxalic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-ethyl (2R,5R)-5-aminopiperidine-1,2-dicarboxylate;oxalic acid (CAS 2940868-36-8) is a chemical compound with the molecular formula C15H26N2O8 and a molecular weight of 362.38 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2R,5R)-5-aminopiperidine-1,2-dicarboxylate;oxalic acid. InChIKey: WZBARPPAVSBWNL-DHTOPLTISA-N.

Identity
Molecular formulaC15H26N2O8
Molecular weight362.38 g/mol
IUPAC name1-O-tert-butyl 2-O-ethyl (2R,5R)-5-aminopiperidine-1,2-dicarboxylate;oxalic acid
InChIKeyWZBARPPAVSBWNL-DHTOPLTISA-N
SMILESCCOC(=O)[C@H]1CC[C@H](CN1C(=O)OC(C)(C)C)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)