Products 2940871-20-3
CAS 2940871-20-3 is the registry number for [1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
[1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol;hydrochloride (CAS 2940871-20-3) is a chemical compound with the molecular formula C9H17ClFNO and a molecular weight of 209.69 g/mol. IUPAC name: [1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol;hydrochloride. InChIKey: YYXGYYQIJOOPKA-DDWIOCJRSA-N.
| Molecular formula | C9H17ClFNO |
|---|---|
| Molecular weight | 209.69 g/mol |
| IUPAC name | [1-[[(3R)-3-fluoropyrrolidin-1-yl]methyl]cyclopropyl]methanol;hydrochloride |
| InChIKey | YYXGYYQIJOOPKA-DDWIOCJRSA-N |
| SMILES | C1CN(C[C@@H]1F)CC2(CC2)CO.Cl |
Computed by PubChem (NCBI)