CAS 2940871-70-3 is the registry number for (3R,4S)-3-Fluoropiperidine-4-carbonitrile hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(3R,4S)-3-fluoropiperidine-4-carbonitrile;hydrochloride (CAS 2940871-70-3) is a chemical compound with the molecular formula C6H10ClFN2 and a molecular weight of 164.61 g/mol. IUPAC name: (3R,4S)-3-fluoropiperidine-4-carbonitrile;hydrochloride. InChIKey: JWGDJLDCONQATF-GEMLJDPKSA-N.
| Molecular formula | C6H10ClFN2 |
|---|---|
| Molecular weight | 164.61 g/mol |
| IUPAC name | (3R,4S)-3-fluoropiperidine-4-carbonitrile;hydrochloride |
| InChIKey | JWGDJLDCONQATF-GEMLJDPKSA-N |
| SMILES | C1CNC[C@@H]([C@@H]1C#N)F.Cl |
Computed by PubChem (NCBI)