Products 2940871-81-6
CAS 2940871-81-6 is the registry number for oxalic acid,(6S)-1,4-oxazepan-6-ol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Oxalic acid;(6S)-1,4-oxazepan-6-ol (CAS 2940871-81-6) is a chemical compound with the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. IUPAC name: oxalic acid;(6S)-1,4-oxazepan-6-ol. InChIKey: PHCJDIZBNVPMIT-JEDNCBNOSA-N.
| Molecular formula | C7H13NO6 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | oxalic acid;(6S)-1,4-oxazepan-6-ol |
| InChIKey | PHCJDIZBNVPMIT-JEDNCBNOSA-N |
| SMILES | C1COC[C@H](CN1)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)