CAS 2940879-42-3 appears in our catalog under these names: 1-[5-BROMO-6-[(1S)-1-METHOXYETHYL]-3-PYRIDYL]-4-METHYL-PIPERAZINE, 95%, 95%, (S)-1-(5-Bromo-6-(1-methoxyethyl)pyridin-3-yl)-4-methylpiperazine, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
1-[5-bromo-6-[(1S)-1-methoxyethyl]-3-pyridinyl]-4-methylpiperazine (CAS 2940879-42-3) is a chemical compound with the molecular formula C13H20BrN3O and a molecular weight of 314.22 g/mol. IUPAC name: 1-[5-bromo-6-[(1S)-1-methoxyethyl]-3-pyridinyl]-4-methylpiperazine. InChIKey: DNBPXRWWCBWSOK-JTQLQIEISA-N.
| Molecular formula | C13H20BrN3O |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | 1-[5-bromo-6-[(1S)-1-methoxyethyl]-3-pyridinyl]-4-methylpiperazine |
| InChIKey | DNBPXRWWCBWSOK-JTQLQIEISA-N |
| SMILES | C[C@@H](C1=C(C=C(C=N1)N2CCN(CC2)C)Br)OC |
Computed by PubChem (NCBI)