CAS 2940879-73-0 is the registry number for trans-4-(3-amino-2,2,4,4-tetramethyl-cyclobutoxy)benzonitrile,hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-amino-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile;hydrochloride (CAS 2940879-73-0) is a chemical compound with the molecular formula C15H21ClN2O and a molecular weight of 280.79 g/mol. IUPAC name: 4-(3-amino-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile;hydrochloride. InChIKey: RKCKNOUYHAXBBL-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O |
|---|---|
| Molecular weight | 280.79 g/mol |
| IUPAC name | 4-(3-amino-2,2,4,4-tetramethylcyclobutyl)oxybenzonitrile;hydrochloride |
| InChIKey | RKCKNOUYHAXBBL-UHFFFAOYSA-N |
| SMILES | CC1(C(C(C1OC2=CC=C(C=C2)C#N)(C)C)N)C.Cl |
Computed by PubChem (NCBI)