Products 2940879-83-2
CAS 2940879-83-2 is the registry number for (3S,5R)-5-[[bis(4-methoxyphenyl)-phenyl-methoxy]methyl]pyrrolidin-3-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-ol (CAS 2940879-83-2) is a chemical compound with the molecular formula C26H29NO4 and a molecular weight of 419.5 g/mol. IUPAC name: (3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-ol. InChIKey: CJFYBUJBXCVKLN-PKTZIBPZSA-N.
| Molecular formula | C26H29NO4 |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | (3S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]pyrrolidin-3-ol |
| InChIKey | CJFYBUJBXCVKLN-PKTZIBPZSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@H]4C[C@@H](CN4)O |
Computed by PubChem (NCBI)