Products 2940889-52-9
CAS 2940889-52-9 is the registry number for Eucalyptacid A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid (CAS 2940889-52-9) is a chemical compound with the molecular formula C17H32O5 and a molecular weight of 316.4 g/mol. IUPAC name: (E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid. InChIKey: CFMKVZLLXFODQC-IPFREJQMSA-N.
| Molecular formula | C17H32O5 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (E,3R,5R)-3,5,11-trihydroxy-2,10,12-trimethyltetradec-8-enoic acid |
| InChIKey | CFMKVZLLXFODQC-IPFREJQMSA-N |
| SMILES | CCC(C)C(C(C)/C=C/CC[C@H](C[C@H](C(C)C(=O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Eucalyptacid A