CAS 2940940-68-9 appears in our catalog under these names: tert-butyl 5-fluoro-2,7-diazaspiro[3.5]nonane-7-carboxylate hydrochloride, 95%, tert-butyl 5-fluoro-2,7-diazaspiro[3.5]nonane-7-carboxylate,hydrochloride, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
Tert-butyl 5-fluoro-2,7-diazaspiro[3.5]nonane-7-carboxylate;hydrochloride (CAS 2940940-68-9) is a chemical compound with the molecular formula C12H22ClFN2O2 and a molecular weight of 280.77 g/mol. IUPAC name: tert-butyl 5-fluoro-2,7-diazaspiro[3.5]nonane-7-carboxylate;hydrochloride. InChIKey: QFNQURIKCMPOPN-UHFFFAOYSA-N.
| Molecular formula | C12H22ClFN2O2 |
|---|---|
| Molecular weight | 280.77 g/mol |
| IUPAC name | tert-butyl 5-fluoro-2,7-diazaspiro[3.5]nonane-7-carboxylate;hydrochloride |
| InChIKey | QFNQURIKCMPOPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CNC2)C(C1)F.Cl |
Computed by PubChem (NCBI)