CAS 2940943-66-6 appears in our catalog under these names: 4-(2-Aminoethyl)piperazin-2-one 2,2,2-trifluoroacetate, 97%, 4-(2-Aminoethyl)piperazin-2-one 2,2,2-trifluoroacetate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
4-(2-aminoethyl)piperazin-2-one;2,2,2-trifluoroacetic acid (CAS 2940943-66-6) is a chemical compound with the molecular formula C8H14F3N3O3 and a molecular weight of 257.21 g/mol. IUPAC name: 4-(2-aminoethyl)piperazin-2-one;2,2,2-trifluoroacetic acid. InChIKey: KIZSEUGSXPDTLZ-UHFFFAOYSA-N.
| Molecular formula | C8H14F3N3O3 |
|---|---|
| Molecular weight | 257.21 g/mol |
| IUPAC name | 4-(2-aminoethyl)piperazin-2-one;2,2,2-trifluoroacetic acid |
| InChIKey | KIZSEUGSXPDTLZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)CCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)