Products 2940944-29-4
CAS 2940944-29-4 is the registry number for 4-bromo-7-fluoro-3-methyl-1-tetrahydropyran-2-yl-indazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-bromo-7-fluoro-3-methyl-1-(oxan-2-yl)indazole (CAS 2940944-29-4) is a chemical compound with the molecular formula C13H14BrFN2O and a molecular weight of 313.16 g/mol. IUPAC name: 4-bromo-7-fluoro-3-methyl-1-(oxan-2-yl)indazole. InChIKey: KNAVAUDHGCWWFU-UHFFFAOYSA-N.
| Molecular formula | C13H14BrFN2O |
|---|---|
| Molecular weight | 313.16 g/mol |
| IUPAC name | 4-bromo-7-fluoro-3-methyl-1-(oxan-2-yl)indazole |
| InChIKey | KNAVAUDHGCWWFU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C(C=CC(=C12)Br)F)C3CCCCO3 |
Computed by PubChem (NCBI)