Products 2940949-14-2

CAS 2940949-14-2 is the registry number for 3-fluoro-1-methyl-piperidin-4-one hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3-fluoro-1-methylpiperidin-4-one;hydrochloride (CAS 2940949-14-2) is a chemical compound with the molecular formula C6H11ClFNO and a molecular weight of 167.61 g/mol. IUPAC name: 3-fluoro-1-methylpiperidin-4-one;hydrochloride. InChIKey: LPTVFRWPZCNHPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClFNO
Molecular weight167.61 g/mol
IUPAC name3-fluoro-1-methylpiperidin-4-one;hydrochloride
InChIKeyLPTVFRWPZCNHPZ-UHFFFAOYSA-N
SMILESCN1CCC(=O)C(C1)F.Cl

Computed by PubChem (NCBI)