Products 2940956-48-7

CAS 2940956-48-7 is the registry number for methyl 3-(aminomethyl)oxetane-3-carboxylate,hemi(oxalic acid), 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Bis(methyl 3-(aminomethyl)oxetane-3-carboxylate);oxalic acid (CAS 2940956-48-7) is a chemical compound with the molecular formula C14H24N2O10 and a molecular weight of 380.35 g/mol. IUPAC name: bis(methyl 3-(aminomethyl)oxetane-3-carboxylate);oxalic acid. InChIKey: SUBRHZMZABOACG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H24N2O10
Molecular weight380.35 g/mol
IUPAC namebis(methyl 3-(aminomethyl)oxetane-3-carboxylate);oxalic acid
InChIKeySUBRHZMZABOACG-UHFFFAOYSA-N
SMILESCOC(=O)C1(COC1)CN.COC(=O)C1(COC1)CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)