Products 2940960-31-4

CAS 2940960-31-4 is the registry number for 8-bromo-3,5-dihydro-2H-4,1-benzoxathiepine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

8-bromo-3,5-dihydro-2H-4,1-benzoxathiepine (CAS 2940960-31-4) is a chemical compound with the molecular formula C9H9BrOS and a molecular weight of 245.14 g/mol. IUPAC name: 8-bromo-3,5-dihydro-2H-4,1-benzoxathiepine. InChIKey: SEYZDLJVLDLDIT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrOS
Molecular weight245.14 g/mol
IUPAC name8-bromo-3,5-dihydro-2H-4,1-benzoxathiepine
InChIKeySEYZDLJVLDLDIT-UHFFFAOYSA-N
SMILESC1CSC2=C(CO1)C=CC(=C2)Br

Computed by PubChem (NCBI)