CAS 2940962-39-8 is the registry number for ditert-butyl 2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate,hemi(oxalic acid), 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Bis(ditert-butyl 2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate);oxalic acid (CAS 2940962-39-8) is a chemical compound with the molecular formula C34H60N6O12 and a molecular weight of 744.9 g/mol. IUPAC name: bis(ditert-butyl 2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate);oxalic acid. InChIKey: AORXSLJAZGDGOD-UHFFFAOYSA-N.
| Molecular formula | C34H60N6O12 |
|---|---|
| Molecular weight | 744.9 g/mol |
| IUPAC name | bis(ditert-butyl 2,5,8-triazaspiro[3.5]nonane-2,8-dicarboxylate);oxalic acid |
| InChIKey | AORXSLJAZGDGOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2(C1)CN(C2)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)N1CCNC2(C1)CN(C2)C(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)