Products 2940963-40-4

CAS 2940963-40-4 is the registry number for 5-fluoro-4-iodo-1,3-dihydropyrrolo[2,3-b]pyridin-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

5-fluoro-4-iodo-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (CAS 2940963-40-4) is a chemical compound with the molecular formula C7H4FIN2O and a molecular weight of 278.02 g/mol. IUPAC name: 5-fluoro-4-iodo-1,3-dihydropyrrolo[2,3-b]pyridin-2-one. InChIKey: MCQMCFYBJXUCKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4FIN2O
Molecular weight278.02 g/mol
IUPAC name5-fluoro-4-iodo-1,3-dihydropyrrolo[2,3-b]pyridin-2-one
InChIKeyMCQMCFYBJXUCKZ-UHFFFAOYSA-N
SMILESC1C2=C(C(=CN=C2NC1=O)F)I

Computed by PubChem (NCBI)