Products 29411-04-9

CAS 29411-04-9 is the registry number for S-(4-chlorophenyl) methylcarbamothioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

S-(4-chlorophenyl) N-methylcarbamothioate (CAS 29411-04-9) is a chemical compound with the molecular formula C8H8ClNOS and a molecular weight of 201.67 g/mol. IUPAC name: S-(4-chlorophenyl) N-methylcarbamothioate. InChIKey: WJACIPICDGLBKG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClNOS
Molecular weight201.67 g/mol
IUPAC nameS-(4-chlorophenyl) N-methylcarbamothioate
InChIKeyWJACIPICDGLBKG-UHFFFAOYSA-N
SMILESCNC(=O)SC1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)