CAS 294194-13-1 is the registry number for 2-(4-Chlorophenyl)-4-hydroxy-4-methyl-6-oxo-1,3-Cyclohexanedicarboxylic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 100mg.
Diethyl 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (CAS 294194-13-1) is a chemical compound with the molecular formula C19H23ClO6 and a molecular weight of 382.8 g/mol. IUPAC name: diethyl 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate. InChIKey: SNYBQIIVGREIAE-UHFFFAOYSA-N.
| Molecular formula | C19H23ClO6 |
|---|---|
| Molecular weight | 382.8 g/mol |
| IUPAC name | diethyl 2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| InChIKey | SNYBQIIVGREIAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(C(C(CC1=O)(C)O)C(=O)OCC)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)