CAS 2942-40-7 appears in our catalog under these names: 4–nitro–1H–indazole, 4-Nitro-1H-indazole 95%, 4-Nitro-1H-indazole, 95%, 95%, 4-Nitro-1H-indazole, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 250mg, 1g, 5g, 10g, 50g, 250g.
4-nitro-1H-indazole (CAS 2942-40-7) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 4-nitro-1H-indazole. InChIKey: WBTVZVUYPVQEIF-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 4-nitro-1H-indazole |
| InChIKey | WBTVZVUYPVQEIF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)