CAS 2942231-48-1 is the registry number for STING agonist-42. Offered by: MedChemExpress. Available pack sizes: Get quote.
Lithium 4-ethynyl-5-fluoro-2-[[6-(4-fluoroimidazol-1-yl)pyridazine-3-carbonyl]amino]benzoate (CAS 2942231-48-1) is a chemical compound with the molecular formula C17H8F2LiN5O3 and a molecular weight of 375.2 g/mol. IUPAC name: lithium 4-ethynyl-5-fluoro-2-[[6-(4-fluoroimidazol-1-yl)pyridazine-3-carbonyl]amino]benzoate. InChIKey: HLVYIJDTFAOXAB-UHFFFAOYSA-M.
| Molecular formula | C17H8F2LiN5O3 |
|---|---|
| Molecular weight | 375.2 g/mol |
| IUPAC name | lithium 4-ethynyl-5-fluoro-2-[[6-(4-fluoroimidazol-1-yl)pyridazine-3-carbonyl]amino]benzoate |
| InChIKey | HLVYIJDTFAOXAB-UHFFFAOYSA-M |
| SMILES | [Li+].C#CC1=CC(=C(C=C1F)C(=O)[O-])NC(=O)C2=NN=C(C=C2)N3C=C(N=C3)F |
Computed by PubChem (NCBI)