CAS 2942527-73-1 is the registry number for L-Lysine-L-Amphetamine Dimethanesulfonate salt. Offered by: TRC. Available pack sizes: 100mg.
(2S)-2,6-diamino-N-[(2R)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid (CAS 2942527-73-1) is a chemical compound with the molecular formula C17H33N3O7S2 and a molecular weight of 455.6 g/mol. IUPAC name: (2S)-2,6-diamino-N-[(2R)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid. InChIKey: CETWSOHVEGTIBR-DAIKJZOUSA-N.
| Molecular formula | C17H33N3O7S2 |
|---|---|
| Molecular weight | 455.6 g/mol |
| IUPAC name | (2S)-2,6-diamino-N-[(2R)-1-phenylpropan-2-yl]hexanamide;methanesulfonic acid |
| InChIKey | CETWSOHVEGTIBR-DAIKJZOUSA-N |
| SMILES | C[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CCCCN)N.CS(=O)(=O)O.CS(=O)(=O)O |
Computed by PubChem (NCBI)