Products 29444-25-5
CAS 29444-25-5 is the registry number for 9-cis,13-cis-Retinol. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol (CAS 29444-25-5) is a chemical compound with the molecular formula C20H30O and a molecular weight of 286.5 g/mol. IUPAC name: (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol. InChIKey: FPIPGXGPPPQFEQ-BOOMUCAASA-N.
| Molecular formula | C20H30O |
|---|---|
| Molecular weight | 286.5 g/mol |
| IUPAC name | (2Z,4E,6Z,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
| InChIKey | FPIPGXGPPPQFEQ-BOOMUCAASA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C\C(=C/CO)\C)/C |
Computed by PubChem (NCBI)