CAS 29457-72-5 is the registry number for Lithium Perfluorooctanesulfonate. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (CAS 29457-72-5) is a chemical compound with the molecular formula C8F17LiO3S and a molecular weight of 506.1 g/mol. IUPAC name: lithium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate. InChIKey: XVCUGNWRDDNCRD-UHFFFAOYSA-M.
| Molecular formula | C8F17LiO3S |
|---|---|
| Molecular weight | 506.1 g/mol |
| IUPAC name | lithium 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| InChIKey | XVCUGNWRDDNCRD-UHFFFAOYSA-M |
| SMILES | [Li+].C(C(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)