Products 29462-19-9
CAS 29462-19-9 is the registry number for Bentazepam (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
5-phenyl-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepin-2-one;hydrochloride (CAS 29462-19-9) is a chemical compound with the molecular formula C17H17ClN2OS and a molecular weight of 332.8 g/mol. IUPAC name: 5-phenyl-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepin-2-one;hydrochloride. InChIKey: BDKMFXIJRRQGOK-UHFFFAOYSA-N.
| Molecular formula | C17H17ClN2OS |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 5-phenyl-1,3,6,7,8,9-hexahydro-[1]benzothiolo[2,3-e][1,4]diazepin-2-one;hydrochloride |
| InChIKey | BDKMFXIJRRQGOK-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)NC(=O)CN=C3C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)