CAS 294622-47-2 is the registry number for 4-(2-(4-Methylpiperazin-1-yl)thiazol-4-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzoic acid (CAS 294622-47-2) is a chemical compound with the molecular formula C15H17N3O2S and a molecular weight of 303.4 g/mol. IUPAC name: 4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzoic acid. InChIKey: NPHPALJCGYEBNO-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O2S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzoic acid |
| InChIKey | NPHPALJCGYEBNO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC(=CS2)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)