Products 294622-47-2

CAS 294622-47-2 is the registry number for 4-(2-(4-Methylpiperazin-1-yl)thiazol-4-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzoic acid (CAS 294622-47-2) is a chemical compound with the molecular formula C15H17N3O2S and a molecular weight of 303.4 g/mol. IUPAC name: 4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzoic acid. InChIKey: NPHPALJCGYEBNO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17N3O2S
Molecular weight303.4 g/mol
IUPAC name4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzoic acid
InChIKeyNPHPALJCGYEBNO-UHFFFAOYSA-N
SMILESCN1CCN(CC1)C2=NC(=CS2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)