CAS 29473-30-1 is the registry number for Cyclopenta-2,4-dien-1-ylidenetriphenylphosphorane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopenta-2,4-dien-1-ylidene(triphenyl)-lambda5-phosphane (CAS 29473-30-1) is a chemical compound with the molecular formula C23H19P and a molecular weight of 326.4 g/mol. IUPAC name: cyclopenta-2,4-dien-1-ylidene(triphenyl)-lambda5-phosphane. InChIKey: MXGWLWRROFTJDZ-UHFFFAOYSA-N.
| Molecular formula | C23H19P |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | cyclopenta-2,4-dien-1-ylidene(triphenyl)-lambda5-phosphane |
| InChIKey | MXGWLWRROFTJDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=C2C=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)