Products 29477-88-1
CAS 29477-88-1 appears in our catalog under these names: Methylergometrinine (Methylergometrine EP impurity H), Methylergometrine Impurity 8（Methylergometrine EP Impurity H）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(6aR,9S)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (CAS 29477-88-1) is a chemical compound with the molecular formula C20H25N3O2 and a molecular weight of 339.4 g/mol. IUPAC name: (6aR,9S)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide. InChIKey: UNBRKDKAWYKMIV-SUNYJGFJSA-N.
| Molecular formula | C20H25N3O2 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | (6aR,9S)-N-[(2S)-1-hydroxybutan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | UNBRKDKAWYKMIV-SUNYJGFJSA-N |
| SMILES | CC[C@@H](CO)NC(=O)[C@@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C |
Computed by PubChem (NCBI)