Products 2948304-00-3
CAS 2948304-00-3 is the registry number for AMPK activator 11. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[2-(4-hydroxyphenyl)ethylamino]quinazolin-2-yl]-1H-indole-3-carbaldehyde (CAS 2948304-00-3) is a chemical compound with the molecular formula C25H20N4O2 and a molecular weight of 408.5 g/mol. IUPAC name: 2-[4-[2-(4-hydroxyphenyl)ethylamino]quinazolin-2-yl]-1H-indole-3-carbaldehyde. InChIKey: YMGXGEHUEKZAQE-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O2 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 2-[4-[2-(4-hydroxyphenyl)ethylamino]quinazolin-2-yl]-1H-indole-3-carbaldehyde |
| InChIKey | YMGXGEHUEKZAQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=NC4=CC=CC=C4C(=N3)NCCC5=CC=C(C=C5)O)C=O |
Computed by PubChem (NCBI)
Synonyms:
AMPK activator 11, orb1944302