Products 2948338-60-9
CAS 2948338-60-9 is the registry number for Anticancer agent 142. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[3-bromo-5-carbamoyl-7-(3-sulfamoylpropoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (CAS 2948338-60-9) is a chemical compound with the molecular formula C13H14BrF2N2O7PS2 and a molecular weight of 523.3 g/mol. IUPAC name: [[3-bromo-5-carbamoyl-7-(3-sulfamoylpropoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid. InChIKey: PWHDUPBMMZXPOG-UHFFFAOYSA-N.
| Molecular formula | C13H14BrF2N2O7PS2 |
|---|---|
| Molecular weight | 523.3 g/mol |
| IUPAC name | [[3-bromo-5-carbamoyl-7-(3-sulfamoylpropoxy)-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| InChIKey | PWHDUPBMMZXPOG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=C(S2)C(F)(F)P(=O)(O)O)Br)OCCCS(=O)(=O)N)C(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 142, orb2277631