Products 2950167-07-2
CAS 2950167-07-2 is the registry number for IZS-M. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium (2S)-2-imidazol-1-yl-4-methylsulfanylbutanoate (CAS 2950167-07-2) is a chemical compound with the molecular formula C8H11N2NaO2S and a molecular weight of 222.24 g/mol. IUPAC name: sodium (2S)-2-imidazol-1-yl-4-methylsulfanylbutanoate. InChIKey: UVZSWUUNZRKXEG-FJXQXJEOSA-M.
| Molecular formula | C8H11N2NaO2S |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | sodium (2S)-2-imidazol-1-yl-4-methylsulfanylbutanoate |
| InChIKey | UVZSWUUNZRKXEG-FJXQXJEOSA-M |
| SMILES | CSCC[C@@H](C(=O)[O-])N1C=CN=C1.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
IZS-M, orb3137148