CAS 29514-94-1 is the registry number for 2-Fluorosulfonyltetrafluoroethyl trifluorovinyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonyl fluoride (CAS 29514-94-1) is a chemical compound with the molecular formula C4F8O3S and a molecular weight of 280.10 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonyl fluoride. InChIKey: VQUGQIYAVYQSAB-UHFFFAOYSA-N.
| Molecular formula | C4F8O3S |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethanesulfonyl fluoride |
| InChIKey | VQUGQIYAVYQSAB-UHFFFAOYSA-N |
| SMILES | C(=C(F)F)(OC(C(F)(F)S(=O)(=O)F)(F)F)F |
Computed by PubChem (NCBI)