Products 2953023-80-6
CAS 2953023-80-6 is the registry number for DNA polymerase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(acetylsulfanylmethyl)-2-oxochromen-7-yl] acetate (CAS 2953023-80-6) is a chemical compound with the molecular formula C14H12O5S and a molecular weight of 292.31 g/mol. IUPAC name: [4-(acetylsulfanylmethyl)-2-oxochromen-7-yl] acetate. InChIKey: UIQDNATWWCZOHR-UHFFFAOYSA-N.
| Molecular formula | C14H12O5S |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | [4-(acetylsulfanylmethyl)-2-oxochromen-7-yl] acetate |
| InChIKey | UIQDNATWWCZOHR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C(=CC(=O)O2)CSC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
DNA polymerase-IN-2