CAS 2953345-44-1 is the registry number for N,N–DMT–d4 (fumarate). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(E)-but-2-enedioic acid;1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine (CAS 2953345-44-1) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 308.36 g/mol. IUPAC name: (E)-but-2-enedioic acid;1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine. InChIKey: OHMVTPSXVQQKPA-IORFDXRYSA-N.
| Molecular formula | C16H20N2O4 |
|---|---|
| Molecular weight | 308.36 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| InChIKey | OHMVTPSXVQQKPA-IORFDXRYSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=CC=CC=C21)C([2H])([2H])N(C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)