CAS 295357-73-2 appears in our catalog under these names: Lenalidomide Impurity 13, Lenalidomide Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid (CAS 295357-73-2) is a chemical compound with the molecular formula C13H13N3O6 and a molecular weight of 307.26 g/mol. IUPAC name: 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid. InChIKey: JWXSMBGQHOFVJT-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O6 |
|---|---|
| Molecular weight | 307.26 g/mol |
| IUPAC name | 5-amino-2-(7-nitro-3-oxo-1H-isoindol-2-yl)-5-oxopentanoic acid |
| InChIKey | JWXSMBGQHOFVJT-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2[N+](=O)[O-])C(=O)N1C(CCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)