Products 2953730-35-1
CAS 2953730-35-1 is the registry number for BCRP-IN-2. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.
N-(4-azidophenyl)-2-pyridin-4-ylquinazolin-4-amine (CAS 2953730-35-1) is a chemical compound with the molecular formula C19H13N7 and a molecular weight of 339.4 g/mol. IUPAC name: N-(4-azidophenyl)-2-pyridin-4-ylquinazolin-4-amine. InChIKey: RKCAPAXYHIXQLP-UHFFFAOYSA-N.
| Molecular formula | C19H13N7 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | N-(4-azidophenyl)-2-pyridin-4-ylquinazolin-4-amine |
| InChIKey | RKCAPAXYHIXQLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CC=NC=C3)NC4=CC=C(C=C4)N=[N+]=[N-] |
Computed by PubChem (NCBI)