CAS 2954-94-1 is the registry number for Dicyclohexyltin dibromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Dibromo(dicyclohexyl)stannane (CAS 2954-94-1) is a chemical compound with the molecular formula C12H22Br2Sn and a molecular weight of 444.82 g/mol. IUPAC name: dibromo(dicyclohexyl)stannane. InChIKey: RHFTTZVNBAHQBF-UHFFFAOYSA-L.
| Molecular formula | C12H22Br2Sn |
|---|---|
| Molecular weight | 444.82 g/mol |
| IUPAC name | dibromo(dicyclohexyl)stannane |
| InChIKey | RHFTTZVNBAHQBF-UHFFFAOYSA-L |
| SMILES | C1CCC(CC1)[Sn](C2CCCCC2)(Br)Br |
Computed by PubChem (NCBI)