Products 2954726-03-3
CAS 2954726-03-3 is the registry number for tert-butyl (1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane-6-carboxylate, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Tert-butyl (1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane-6-carboxylate (CAS 2954726-03-3) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane-6-carboxylate. InChIKey: AGRWFASKUGVNRK-BDAKNGLRSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane-6-carboxylate |
| InChIKey | AGRWFASKUGVNRK-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCO[C@@H]2[C@H]1C2 |
Computed by PubChem (NCBI)