CAS 2954727-05-8 appears in our catalog under these names: (1S,7R)-2-Oxa-6-azabicyclo[5.1.0]octane hydrochloride, 97%, 97%, (1S,7R)-2-Oxa-6-azabicyclo[5.1.0]octane hydrochloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane;hydrochloride (CAS 2954727-05-8) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane;hydrochloride. InChIKey: DBQNTJWQSLIPFQ-IBTYICNHSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1S,7R)-2-oxa-6-azabicyclo[5.1.0]octane;hydrochloride |
| InChIKey | DBQNTJWQSLIPFQ-IBTYICNHSA-N |
| SMILES | C1CN[C@@H]2C[C@@H]2OC1.Cl |
Computed by PubChem (NCBI)